C23H34O3 — CID 58765090
(13S,17S)-16-[2-(2-hydroxyethoxy)ethyl]-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 58765090) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (13S,17S)-16-[2-(2-hydroxyethoxy)ethyl]-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (13S,17S)-16-[2-(2-hydroxyethoxy)ethyl]-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 58765090 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (13S,17S)-16-[2-(2-hydroxyethoxy)ethyl]-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | Cc1ccc2c(c1)CCC1C2CC[C@@]2(C)C1CC(CCOCCO)[C@@H]2O |
| InChI | InChI=1S/C23H34O3/c1-15-3-5-18-16(13-15)4-6-20-19(18)7-9-23(2)21(20)14-17(22(23)25)8-11-26-12-10-24/h3,5,13,17,19-22,24-25H,4,6-12,14H2,1-2H3/t17?,19?,20?,21?,22-,23-/m0/s1 |
| InChIKey | GGIOPVOLWNNOEX-VCSRSDQLSA-N |
| XLogP | 3.84 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|