About 10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one
10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one (PubChem CID 58765114) has the molecular formula C18H31NO
and a molecular weight of 277.45 g/mol. Its IUPAC name is 10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one.
Molecular Properties
| Compound Name | 10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one |
| PubChem CID | 58765114 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one |
| SMILES | CC(C)(C)C1C(=O)NC2CCCCC2C2CCCCC21 |
| InChI | InChI=1S/C18H31NO/c1-18(2,3)16-14-10-5-4-8-12(14)13-9-6-7-11-15(13)19-17(16)20/h12-16H,4-11H2,1-3H3,(H,19,20) |
| InChIKey | BCKCNNWINRSOPB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one?
The IUPAC name of 10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one (CID 58765114) is 10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one.
What is the SMILES notation for 10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one?
The canonical SMILES for 10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one is CC(C)(C)C1C(=O)NC2CCCCC2C2CCCCC21.
What is the InChIKey of 10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one?
The InChIKey is BCKCNNWINRSOPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO/c1-18(2,3)16-14-10-5-4-8-12(14)13-9-6-7-11-15(13)19-17(16)20/h12-16H,4-11H2,1-3H3,(H,19,20).
What are the key properties of 10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one?
10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one has a molecular weight of 277.45 g/mol, XLogP of 4.14, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-tert-butyl-8-azatricyclo[9.4.0.02,7]pentadecan-9-one is sourced from PubChem (CID 58765114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).