About 2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide
2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide (PubChem CID 587652) has the molecular formula C8H14F3NO
and a molecular weight of 197.20 g/mol. Its IUPAC name is 2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide |
| PubChem CID | 587652 |
| Molecular Formula | C8H14F3NO |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide |
| SMILES | CC(C)N(C(=O)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C8H14F3NO/c1-5(2)12(6(3)4)7(13)8(9,10)11/h5-6H,1-4H3 |
| InChIKey | DBGATAOZCQOMHN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide?
The IUPAC name of 2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide (CID 587652) is 2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide.
What is the SMILES notation for 2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide?
The canonical SMILES for 2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide is CC(C)N(C(=O)C(F)(F)F)C(C)C.
What is the InChIKey of 2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide?
The InChIKey is DBGATAOZCQOMHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO/c1-5(2)12(6(3)4)7(13)8(9,10)11/h5-6H,1-4H3.
What are the key properties of 2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide?
2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide has a molecular weight of 197.20 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-N,N-di(propan-2-yl)acetamide is sourced from PubChem (CID 587652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).