C10H17N3O — CID 58765368
3-[[(1R,2R)-2-aminocyclohexyl]amino]-1,2-dihydropyrrol-5-one (PubChem CID 58765368) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-[[(1R,2R)-2-aminocyclohexyl]amino]-1,2-dihydropyrrol-5-one.
| Compound Name | 3-[[(1R,2R)-2-aminocyclohexyl]amino]-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 58765368 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-[[(1R,2R)-2-aminocyclohexyl]amino]-1,2-dihydropyrrol-5-one |
| SMILES | N[C@@H]1CCCC[C@H]1NC1=CC(=O)NC1 |
| InChI | InChI=1S/C10H17N3O/c11-8-3-1-2-4-9(8)13-7-5-10(14)12-6-7/h5,8-9,13H,1-4,6,11H2,(H,12,14)/t8-,9-/m1/s1 |
| InChIKey | ZCGUVTAVRMRQOP-RKDXNWHRSA-N |
| XLogP | -0.14 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |