C7H12N2O — CID 587654
N,N,4,5-tetramethyl-1,3-oxazol-2-amine (PubChem CID 587654) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is N,N,4,5-tetramethyl-1,3-oxazol-2-amine.
| Compound Name | N,N,4,5-tetramethyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 587654 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | N,N,4,5-tetramethyl-1,3-oxazol-2-amine |
| SMILES | Cc1nc(N(C)C)oc1C |
| InChI | InChI=1S/C7H12N2O/c1-5-6(2)10-7(8-5)9(3)4/h1-4H3 |
| InChIKey | ANTHEQUZEFGQQI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |