C31H31NO3S — CID 58765624
5-[[6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalen-2-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 58765624) has the molecular formula C31H31NO3S and a molecular weight of 497.66 g/mol. Its IUPAC name is 5-[[6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalen-2-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalen-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58765624 |
| Molecular Formula | C31H31NO3S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 5-[[6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalen-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(-c2ccc3cc(CC4SC(=O)NC4=O)ccc3c2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C31H31NO3S/c1-35-27-7-6-25(14-26(27)31-15-19-8-20(16-31)10-21(9-19)17-31)24-5-4-22-11-18(2-3-23(22)13-24)12-28-29(33)32-30(34)36-28/h2-7,11,13-14,19-21,28H,8-10,12,15-17H2,1H3,(H,32,33,34) |
| InChIKey | HJKJODWFCZHAMW-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|