About tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium
tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium (PubChem CID 58765978) has the molecular formula C12H24N+
and a molecular weight of 182.33 g/mol. Its IUPAC name is tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium.
Molecular Properties
| Compound Name | tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium |
| PubChem CID | 58765978 |
| Molecular Formula | C12H24N+ |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.19 |
| IUPAC Name | tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium |
| SMILES | C/[N+](=C\C=C/C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H24N/c1-11(2,3)9-8-10-13(7)12(4,5)6/h8-10H,1-7H3/q+1/b9-8-,13-10+ |
| InChIKey | VXLXQYMNFNRLGK-JQHRQWORSA-N |
| XLogP | 3.10 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium?
The IUPAC name of tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium (CID 58765978) is tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium.
What is the SMILES notation for tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium?
The canonical SMILES for tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium is C/[N+](=C\C=C/C(C)(C)C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium?
The InChIKey is VXLXQYMNFNRLGK-JQHRQWORSA-N. The full InChI is InChI=1S/C12H24N/c1-11(2,3)9-8-10-13(7)12(4,5)6/h8-10H,1-7H3/q+1/b9-8-,13-10+.
What are the key properties of tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium?
tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium has a molecular weight of 182.33 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(Z)-4,4-dimethylpent-2-enylidene]-methylazanium is sourced from PubChem (CID 58765978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).