C37H20N2O7S — CID 58766210
3-methyl-5-(6,8,17,19-tetraoxo-18-phenyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaen-7-yl)benzenesulfonic acid (PubChem CID 58766210) has the molecular formula C37H20N2O7S and a molecular weight of 636.64 g/mol. Its IUPAC name is 3-methyl-5-(6,8,17,19-tetraoxo-18-phenyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaen-7-yl)benzenesulfonic acid.
| Compound Name | 3-methyl-5-(6,8,17,19-tetraoxo-18-phenyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaen-7-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 58766210 |
| Molecular Formula | C37H20N2O7S |
| Molecular Weight | 636.64 g/mol |
| Exact Mass | 636.10 |
| IUPAC Name | 3-methyl-5-(6,8,17,19-tetraoxo-18-phenyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaen-7-yl)benzenesulfonic acid |
| SMILES | Cc1cc(N2C(=O)c3ccc4c5ccc6c7c(ccc(c8ccc(c3c48)C2=O)c75)C(=O)N(c2ccccc2)C6=O)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C37H20N2O7S/c1-18-15-20(17-21(16-18)47(44,45)46)39-36(42)28-13-9-24-22-7-11-26-32-27(35(41)38(34(26)40)19-5-3-2-4-6-19)12-8-23(30(22)32)25-10-14-29(37(39)43)33(28)31(24)25/h2-17H,1H3,(H,44,45,46) |
| InChIKey | QWNSZSPELOWOSH-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.64 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|