About 4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide
4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide (PubChem CID 58766215) has the molecular formula C11H21NO6
and a molecular weight of 263.29 g/mol. Its IUPAC name is 4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide.
Molecular Properties
| Compound Name | 4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide |
| PubChem CID | 58766215 |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide |
| SMILES | CNC(=O)C1OC(COC)C(O)C(O)C1COC |
| InChI | InChI=1S/C11H21NO6/c1-12-11(15)10-6(4-16-2)8(13)9(14)7(18-10)5-17-3/h6-10,13-14H,4-5H2,1-3H3,(H,12,15) |
| InChIKey | NWYIALUEGMDGCO-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide?
The IUPAC name of 4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide (CID 58766215) is 4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide.
What is the SMILES notation for 4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide?
The canonical SMILES for 4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide is CNC(=O)C1OC(COC)C(O)C(O)C1COC.
What is the InChIKey of 4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide?
The InChIKey is NWYIALUEGMDGCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO6/c1-12-11(15)10-6(4-16-2)8(13)9(14)7(18-10)5-17-3/h6-10,13-14H,4-5H2,1-3H3,(H,12,15).
What are the key properties of 4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide?
4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide has a molecular weight of 263.29 g/mol, XLogP of -1.87, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxy-3,6-bis(methoxymethyl)-N-methyloxane-2-carboxamide is sourced from PubChem (CID 58766215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).