C24H6F4N2O4 — CID 58766233
10,15,21,25-tetrafluoro-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2(26),3,5(25),9,11,13,15,20,23-decaene-6,8,17,19-tetrone (PubChem CID 58766233) has the molecular formula C24H6F4N2O4 and a molecular weight of 462.31 g/mol. Its IUPAC name is 10,15,21,25-tetrafluoro-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2(26),3,5(25),9,11,13,15,20,23-decaene-6,8,17,19-tetrone.
| Compound Name | 10,15,21,25-tetrafluoro-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2(26),3,5(25),9,11,13,15,20,23-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 58766233 |
| Molecular Formula | C24H6F4N2O4 |
| Molecular Weight | 462.31 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 10,15,21,25-tetrafluoro-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2(26),3,5(25),9,11,13,15,20,23-decaene-6,8,17,19-tetrone |
| SMILES | O=C1NC(=O)c2c(F)cc3c4cc(F)c5c6c(c(F)cc(c7cc(F)c1c2c73)c64)C(=O)NC5=O |
| InChI | InChI=1S/C24H6F4N2O4/c25-9-1-5-6-2-10(26)17-20-14(6)8(4-12(28)18(20)24(34)30-23(17)33)7-3-11(27)16-19(13(5)7)15(9)21(31)29-22(16)32/h1-4H,(H,29,31,32)(H,30,33,34) |
| InChIKey | VZPYLZZDBUUNDE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|