C27H38N3O15P — CID 58766282
2-[2-[bis(carboxymethyl)amino]ethyl-[2-[bis(2-hydroperoxyethyl)amino]-3-[4-(4-phosphonooxyphenyl)phenoxy]propyl]amino]acetic acid (PubChem CID 58766282) has the molecular formula C27H38N3O15P and a molecular weight of 675.58 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[bis(2-hydroperoxyethyl)amino]-3-[4-(4-phosphonooxyphenyl)phenoxy]propyl]amino]acetic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[bis(2-hydroperoxyethyl)amino]-3-[4-(4-phosphonooxyphenyl)phenoxy]propyl]amino]acetic acid |
|---|---|
| PubChem CID | 58766282 |
| Molecular Formula | C27H38N3O15P |
| Molecular Weight | 675.58 g/mol |
| Exact Mass | 675.20 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[bis(2-hydroperoxyethyl)amino]-3-[4-(4-phosphonooxyphenyl)phenoxy]propyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(COc1ccc(-c2ccc(OP(=O)(O)O)cc2)cc1)N(CCOO)CCOO)CC(=O)O |
| InChI | InChI=1S/C27H38N3O15P/c31-25(32)16-28(9-10-29(17-26(33)34)18-27(35)36)15-22(30(11-13-43-37)12-14-44-38)19-42-23-5-1-20(2-6-23)21-3-7-24(8-4-21)45-46(39,40)41/h1-8,22,37-38H,9-19H2,(H,31,32)(H,33,34)(H,35,36)(H2,39,40,41) |
| InChIKey | XWSZRYYHZDIOCG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 256.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.58 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|