C33H48N4O7 — CID 58766414
(8S,10R)-N-(1-amino-1,2-dioxohexan-3-yl)-5-cyclohexyl-12,12-dimethyl-3,6-dioxo-11,16-dioxa-4,7-diazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-8-carboxamide (PubChem CID 58766414) has the molecular formula C33H48N4O7 and a molecular weight of 612.77 g/mol. Its IUPAC name is (8S,10R)-N-(1-amino-1,2-dioxohexan-3-yl)-5-cyclohexyl-12,12-dimethyl-3,6-dioxo-11,16-dioxa-4,7-diazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-8-carboxamide.
| Compound Name | (8S,10R)-N-(1-amino-1,2-dioxohexan-3-yl)-5-cyclohexyl-12,12-dimethyl-3,6-dioxo-11,16-dioxa-4,7-diazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-8-carboxamide |
|---|---|
| PubChem CID | 58766414 |
| Molecular Formula | C33H48N4O7 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | (8S,10R)-N-(1-amino-1,2-dioxohexan-3-yl)-5-cyclohexyl-12,12-dimethyl-3,6-dioxo-11,16-dioxa-4,7-diazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-8-carboxamide |
| SMILES | CCCC(NC(=O)[C@@H]1C[C@@H]2CN1C(=O)C(C1CCCCC1)NC(=O)Cc1cccc(c1)OCCCC(C)(C)O2)C(=O)C(N)=O |
| InChI | InChI=1S/C33H48N4O7/c1-4-10-25(29(39)30(34)40)35-31(41)26-19-24-20-37(26)32(42)28(22-12-6-5-7-13-22)36-27(38)18-21-11-8-14-23(17-21)43-16-9-15-33(2,3)44-24/h8,11,14,17,22,24-26,28H,4-7,9-10,12-13,15-16,18-20H2,1-3H3,(H2,34,40)(H,35,41)(H,36,38)/t24-,25?,26+,28?/m1/s1 |
| InChIKey | AGMGCRCJKWEZPK-RCWLBROPSA-N |
| XLogP | 2.57 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|