C13H16O4 — CID 58766542
(1S,2S,4R,7E,11R)-4-methyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-ene-12,13-dione (PubChem CID 58766542) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (1S,2S,4R,7E,11R)-4-methyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-ene-12,13-dione.
| Compound Name | (1S,2S,4R,7E,11R)-4-methyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-ene-12,13-dione |
|---|---|
| PubChem CID | 58766542 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (1S,2S,4R,7E,11R)-4-methyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-ene-12,13-dione |
| SMILES | C[C@@]12CC/C=C/CC[C@H]3C(=O)C(=O)O[C@@H]3[C@@H]1O2 |
| InChI | InChI=1S/C13H16O4/c1-13-7-5-3-2-4-6-8-9(14)12(15)16-10(8)11(13)17-13/h2-3,8,10-11H,4-7H2,1H3/b3-2+/t8-,10-,11-,13+/m0/s1 |
| InChIKey | PYFDYSPLPQJYTF-PWJXQNJSSA-N |
| XLogP | 1.38 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|