About 6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium
6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium (PubChem CID 58766550) has the molecular formula C9H16F3ORf-
and a molecular weight of 464.22 g/mol. Its IUPAC name is 6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium.
Molecular Properties
| Compound Name | 6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium |
| PubChem CID | 58766550 |
| Molecular Formula | C9H16F3ORf- |
| Molecular Weight | 464.22 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium |
| SMILES | [CH2-]C(CCCCOCC)C(F)(F)F.[Rf] |
| InChI | InChI=1S/C9H16F3O.Rf/c1-3-13-7-5-4-6-8(2)9(10,11)12;/h8H,2-7H2,1H3;/q-1; |
| InChIKey | RLCHYLMIPZXZMH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium?
The IUPAC name of 6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium (CID 58766550) is 6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium.
What is the SMILES notation for 6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium?
The canonical SMILES for 6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium is [CH2-]C(CCCCOCC)C(F)(F)F.[Rf].
What is the InChIKey of 6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium?
The InChIKey is RLCHYLMIPZXZMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3O.Rf/c1-3-13-7-5-4-6-8(2)9(10,11)12;/h8H,2-7H2,1H3;/q-1;.
What are the key properties of 6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium?
6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium has a molecular weight of 464.22 g/mol, XLogP of 3.21, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-1,1,1-trifluoro-2-methanidylhexane;rutherfordium is sourced from PubChem (CID 58766550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).