C10H17N5 — CID 58766600
9-cyclopentyl-2,3,4,5-tetrahydropurin-6-amine (PubChem CID 58766600) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is 9-cyclopentyl-2,3,4,5-tetrahydropurin-6-amine.
| Compound Name | 9-cyclopentyl-2,3,4,5-tetrahydropurin-6-amine |
|---|---|
| PubChem CID | 58766600 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 9-cyclopentyl-2,3,4,5-tetrahydropurin-6-amine |
| SMILES | NC1=NCNC2C1N=CN2C1CCCC1 |
| InChI | InChI=1S/C10H17N5/c11-9-8-10(13-5-12-9)15(6-14-8)7-3-1-2-4-7/h6-8,10,13H,1-5H2,(H2,11,12) |
| InChIKey | FNJWHKOEINJYDN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |