About tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate
tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate (PubChem CID 58767314) has the molecular formula C19H28N2O2
and a molecular weight of 316.45 g/mol. Its IUPAC name is tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate |
| PubChem CID | 58767314 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate |
| SMILES | C/C=C1\CN(Cc2ccccc2)[C@H](C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28N2O2/c1-6-17-14-20(13-16-10-8-7-9-11-16)15(2)12-21(17)18(22)23-19(3,4)5/h6-11,15H,12-14H2,1-5H3/b17-6+/t15-/m1/s1 |
| InChIKey | JXIJZRUYAQLTLN-DGMYMGAOSA-N |
| XLogP | 4.03 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate?
The IUPAC name of tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate (CID 58767314) is tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate.
What is the SMILES notation for tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate?
The canonical SMILES for tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate is C/C=C1\CN(Cc2ccccc2)[C@H](C)CN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate?
The InChIKey is JXIJZRUYAQLTLN-DGMYMGAOSA-N. The full InChI is InChI=1S/C19H28N2O2/c1-6-17-14-20(13-16-10-8-7-9-11-16)15(2)12-21(17)18(22)23-19(3,4)5/h6-11,15H,12-14H2,1-5H3/b17-6+/t15-/m1/s1.
What are the key properties of tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate?
tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate has a molecular weight of 316.45 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methylpiperazine-1-carboxylate is sourced from PubChem (CID 58767314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).