C22H29Cl2FN10O2 — CID 58767376
3-amino-5-[(3S)-4-[1-(6-amino-2-chloro-5-fluoropyridine-3-carbonyl)piperidin-4-yl]-3-ethylpiperazin-1-yl]-6-chloropyrazine-2-carbohydrazide (PubChem CID 58767376) has the molecular formula C22H29Cl2FN10O2 and a molecular weight of 555.45 g/mol. Its IUPAC name is 3-amino-5-[(3S)-4-[1-(6-amino-2-chloro-5-fluoropyridine-3-carbonyl)piperidin-4-yl]-3-ethylpiperazin-1-yl]-6-chloropyrazine-2-carbohydrazide.
| Compound Name | 3-amino-5-[(3S)-4-[1-(6-amino-2-chloro-5-fluoropyridine-3-carbonyl)piperidin-4-yl]-3-ethylpiperazin-1-yl]-6-chloropyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 58767376 |
| Molecular Formula | C22H29Cl2FN10O2 |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 3-amino-5-[(3S)-4-[1-(6-amino-2-chloro-5-fluoropyridine-3-carbonyl)piperidin-4-yl]-3-ethylpiperazin-1-yl]-6-chloropyrazine-2-carbohydrazide |
| SMILES | CC[C@H]1CN(c2nc(N)c(C(=O)NN)nc2Cl)CCN1C1CCN(C(=O)c2cc(F)c(N)nc2Cl)CC1 |
| InChI | InChI=1S/C22H29Cl2FN10O2/c1-2-11-10-34(20-17(24)29-15(19(27)31-20)21(36)32-28)7-8-35(11)12-3-5-33(6-4-12)22(37)13-9-14(25)18(26)30-16(13)23/h9,11-12H,2-8,10,28H2,1H3,(H2,26,30)(H2,27,31)(H,32,36)/t11-/m0/s1 |
| InChIKey | BJQVOJMFNOYHOD-NSHDSACASA-N |
| XLogP | 1.29 |
| TPSA | 172.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|