About 1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile
1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile (PubChem CID 58767510) has the molecular formula C20H19N3O3
and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile |
| PubChem CID | 58767510 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile |
| SMILES | COc1ccc2c(NC[C@@H](O)CO)nc(C#N)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C20H19N3O3/c1-26-18-8-7-16-17(19(18)13-5-3-2-4-6-13)9-14(10-21)23-20(16)22-11-15(25)12-24/h2-9,15,24-25H,11-12H2,1H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | QGZKJFIQKYXXCJ-OAHLLOKOSA-N |
| XLogP | 2.55 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile?
The IUPAC name of 1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile (CID 58767510) is 1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile.
What is the SMILES notation for 1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile?
The canonical SMILES for 1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile is COc1ccc2c(NC[C@@H](O)CO)nc(C#N)cc2c1-c1ccccc1.
What is the InChIKey of 1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile?
The InChIKey is QGZKJFIQKYXXCJ-OAHLLOKOSA-N. The full InChI is InChI=1S/C20H19N3O3/c1-26-18-8-7-16-17(19(18)13-5-3-2-4-6-13)9-14(10-21)23-20(16)22-11-15(25)12-24/h2-9,15,24-25H,11-12H2,1H3,(H,22,23)/t15-/m1/s1.
What are the key properties of 1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile?
1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile has a molecular weight of 349.39 g/mol, XLogP of 2.55, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2R)-2,3-dihydroxypropyl]amino]-6-methoxy-5-phenylisoquinoline-3-carbonitrile is sourced from PubChem (CID 58767510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).