C24H39ClN8O4 — CID 58767666
tert-butyl 4-[(2S)-4-(9-chloro-2,7-dioxo-3,4,5,6,7a,11a-hexahydro-1H-pyrazino[2,3-h][1,3,6]triazonin-10-yl)-2-ethylpiperazin-1-yl]piperidine-1-carboxylate (PubChem CID 58767666) has the molecular formula C24H39ClN8O4 and a molecular weight of 539.08 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-4-(9-chloro-2,7-dioxo-3,4,5,6,7a,11a-hexahydro-1H-pyrazino[2,3-h][1,3,6]triazonin-10-yl)-2-ethylpiperazin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S)-4-(9-chloro-2,7-dioxo-3,4,5,6,7a,11a-hexahydro-1H-pyrazino[2,3-h][1,3,6]triazonin-10-yl)-2-ethylpiperazin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58767666 |
| Molecular Formula | C24H39ClN8O4 |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | tert-butyl 4-[(2S)-4-(9-chloro-2,7-dioxo-3,4,5,6,7a,11a-hexahydro-1H-pyrazino[2,3-h][1,3,6]triazonin-10-yl)-2-ethylpiperazin-1-yl]piperidine-1-carboxylate |
| SMILES | CC[C@H]1CN(C2=NC3NC(=O)NCCNC(=O)C3N=C2Cl)CCN1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H39ClN8O4/c1-5-15-14-32(12-13-33(15)16-6-10-31(11-7-16)23(36)37-24(2,3)4)20-18(25)28-17-19(29-20)30-22(35)27-9-8-26-21(17)34/h15-17,19H,5-14H2,1-4H3,(H,26,34)(H2,27,30,35)/t15-,17?,19?/m0/s1 |
| InChIKey | BLWTVCHLLCGRPQ-DMKPSLHHSA-N |
| XLogP | 0.96 |
| TPSA | 130.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |