C15H25NO7 — CID 587679
1-O-tert-butyl 2-O,2-O'-diethyl 5-hydroxypyrrolidine-1,2,2-tricarboxylate (PubChem CID 587679) has the molecular formula C15H25NO7 and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O,2-O'-diethyl 5-hydroxypyrrolidine-1,2,2-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O,2-O'-diethyl 5-hydroxypyrrolidine-1,2,2-tricarboxylate |
|---|---|
| PubChem CID | 587679 |
| Molecular Formula | C15H25NO7 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-O-tert-butyl 2-O,2-O'-diethyl 5-hydroxypyrrolidine-1,2,2-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCC(O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO7/c1-6-21-11(18)15(12(19)22-7-2)9-8-10(17)16(15)13(20)23-14(3,4)5/h10,17H,6-9H2,1-5H3 |
| InChIKey | OEXKWEMWGTVYDJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|