C30H40F2N8O3 — CID 58768080
methyl 2-(3,4-difluorophenyl)-2-[4-[(2S,5R)-2-ethyl-4-[5-[5-(ethylamino)-1,3,4-oxadiazol-2-yl]-3-methylpyrazin-2-yl]-5-methylpiperazin-1-yl]piperidin-1-yl]acetate (PubChem CID 58768080) has the molecular formula C30H40F2N8O3 and a molecular weight of 598.70 g/mol. Its IUPAC name is methyl 2-(3,4-difluorophenyl)-2-[4-[(2S,5R)-2-ethyl-4-[5-[5-(ethylamino)-1,3,4-oxadiazol-2-yl]-3-methylpyrazin-2-yl]-5-methylpiperazin-1-yl]piperidin-1-yl]acetate.
| Compound Name | methyl 2-(3,4-difluorophenyl)-2-[4-[(2S,5R)-2-ethyl-4-[5-[5-(ethylamino)-1,3,4-oxadiazol-2-yl]-3-methylpyrazin-2-yl]-5-methylpiperazin-1-yl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 58768080 |
| Molecular Formula | C30H40F2N8O3 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | methyl 2-(3,4-difluorophenyl)-2-[4-[(2S,5R)-2-ethyl-4-[5-[5-(ethylamino)-1,3,4-oxadiazol-2-yl]-3-methylpyrazin-2-yl]-5-methylpiperazin-1-yl]piperidin-1-yl]acetate |
| SMILES | CCNc1nnc(-c2cnc(N3C[C@H](CC)N(C4CCN(C(C(=O)OC)c5ccc(F)c(F)c5)CC4)C[C@H]3C)c(C)n2)o1 |
| InChI | InChI=1S/C30H40F2N8O3/c1-6-21-17-39(27-19(4)35-25(15-34-27)28-36-37-30(43-28)33-7-2)18(3)16-40(21)22-10-12-38(13-11-22)26(29(41)42-5)20-8-9-23(31)24(32)14-20/h8-9,14-15,18,21-22,26H,6-7,10-13,16-17H2,1-5H3,(H,33,37)/t18-,21+,26?/m1/s1 |
| InChIKey | YSYAZJOLKCNQTQ-YIRICJMVSA-N |
| XLogP | 4.21 |
| TPSA | 112.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |