C37H34ClF5N4O6 — CID 58768348
N-[(2R)-3-(4-chlorophenyl)-1-oxo-1-[4-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperazin-1-yl]propan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide (PubChem CID 58768348) has the molecular formula C37H34ClF5N4O6 and a molecular weight of 761.14 g/mol. Its IUPAC name is N-[(2R)-3-(4-chlorophenyl)-1-oxo-1-[4-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperazin-1-yl]propan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide.
| Compound Name | N-[(2R)-3-(4-chlorophenyl)-1-oxo-1-[4-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperazin-1-yl]propan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide |
|---|---|
| PubChem CID | 58768348 |
| Molecular Formula | C37H34ClF5N4O6 |
| Molecular Weight | 761.14 g/mol |
| Exact Mass | 760.21 |
| IUPAC Name | N-[(2R)-3-(4-chlorophenyl)-1-oxo-1-[4-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperazin-1-yl]propan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide |
| SMILES | O=C(N[C@H](Cc1ccc(Cl)cc1)C(=O)N1CCN(c2ccccc2CN2CCCCC2=O)CC1)c1cc(=O)c2cc(OC(F)(F)C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C37H34ClF5N4O6/c38-25-10-8-23(9-11-25)19-28(44-34(50)32-21-30(48)27-20-26(12-13-31(27)52-32)53-37(42,43)36(39,40)41)35(51)46-17-15-45(16-18-46)29-6-2-1-5-24(29)22-47-14-4-3-7-33(47)49/h1-2,5-6,8-13,20-21,28H,3-4,7,14-19,22H2,(H,44,50)/t28-/m1/s1 |
| InChIKey | DWGLPNVPKCBZGS-MUUNZHRXSA-N |
| XLogP | 6.18 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.14 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|