C17H14N3O2+ — CID 58768574
17-methyl-9,19-diaza-17-azoniapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione (PubChem CID 58768574) has the molecular formula C17H14N3O2+ and a molecular weight of 292.32 g/mol. Its IUPAC name is 17-methyl-9,19-diaza-17-azoniapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione.
| Compound Name | 17-methyl-9,19-diaza-17-azoniapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione |
|---|---|
| PubChem CID | 58768574 |
| Molecular Formula | C17H14N3O2+ |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 17-methyl-9,19-diaza-17-azoniapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione |
| SMILES | C[n+]1cccc2c3c4c(c5c(c3[nH]c21)CCC5)C(=O)NC4=O |
| InChI | InChI=1S/C17H13N3O2/c1-20-7-3-6-10-11-13-12(16(21)19-17(13)22)8-4-2-5-9(8)14(11)18-15(10)20/h3,6-7H,2,4-5H2,1H3,(H,19,21,22)/p+1 |
| InChIKey | AVGJFBXQKKLQQG-UHFFFAOYSA-O |
| XLogP | 1.52 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|