C33H28O2 — CID 58769124
(1E,6E)-4,4-dibenzyl-1,7-diphenylhepta-1,6-diene-3,5-dione (PubChem CID 58769124) has the molecular formula C33H28O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is (1E,6E)-4,4-dibenzyl-1,7-diphenylhepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-4,4-dibenzyl-1,7-diphenylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 58769124 |
| Molecular Formula | C33H28O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (1E,6E)-4,4-dibenzyl-1,7-diphenylhepta-1,6-diene-3,5-dione |
| SMILES | O=C(/C=C/c1ccccc1)C(Cc1ccccc1)(Cc1ccccc1)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C33H28O2/c34-31(23-21-27-13-5-1-6-14-27)33(25-29-17-9-3-10-18-29,26-30-19-11-4-12-20-30)32(35)24-22-28-15-7-2-8-16-28/h1-24H,25-26H2/b23-21+,24-22+ |
| InChIKey | DLEPXSVEICYPSZ-MBALSZOMSA-N |
| XLogP | 7.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|