C20H18O2 — CID 58769125
(1E,4Z,6E)-5-hydroxy-4-methyl-1,7-diphenylhepta-1,4,6-trien-3-one (PubChem CID 58769125) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is (1E,4Z,6E)-5-hydroxy-4-methyl-1,7-diphenylhepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-5-hydroxy-4-methyl-1,7-diphenylhepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 58769125 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (1E,4Z,6E)-5-hydroxy-4-methyl-1,7-diphenylhepta-1,4,6-trien-3-one |
| SMILES | C/C(C(=O)/C=C/c1ccccc1)=C(O)\C=C\c1ccccc1 |
| InChI | InChI=1S/C20H18O2/c1-16(19(21)14-12-17-8-4-2-5-9-17)20(22)15-13-18-10-6-3-7-11-18/h2-15,21H,1H3/b14-12+,15-13+,19-16- |
| InChIKey | MMSJFEVMVCEVKG-MEDNDPPJSA-N |
| XLogP | 4.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|