C41H34F6O10 — CID 58769298
[4-[2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-[2-methyl-4-(prop-2-enoyloxymethoxy)phenyl]acetyl]oxyphenyl]propan-2-yl]phenoxy]-2-oxoethyl]-3-methylphenoxy]methyl prop-2-enoate (PubChem CID 58769298) has the molecular formula C41H34F6O10 and a molecular weight of 800.70 g/mol. Its IUPAC name is [4-[2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-[2-methyl-4-(prop-2-enoyloxymethoxy)phenyl]acetyl]oxyphenyl]propan-2-yl]phenoxy]-2-oxoethyl]-3-methylphenoxy]methyl prop-2-enoate.
| Compound Name | [4-[2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-[2-methyl-4-(prop-2-enoyloxymethoxy)phenyl]acetyl]oxyphenyl]propan-2-yl]phenoxy]-2-oxoethyl]-3-methylphenoxy]methyl prop-2-enoate |
|---|---|
| PubChem CID | 58769298 |
| Molecular Formula | C41H34F6O10 |
| Molecular Weight | 800.70 g/mol |
| Exact Mass | 800.21 |
| IUPAC Name | [4-[2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-[2-methyl-4-(prop-2-enoyloxymethoxy)phenyl]acetyl]oxyphenyl]propan-2-yl]phenoxy]-2-oxoethyl]-3-methylphenoxy]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCOc1ccc(CC(=O)Oc2ccc(C(c3ccc(OC(=O)Cc4ccc(OCOC(=O)C=C)cc4C)cc3)(C(F)(F)F)C(F)(F)F)cc2)c(C)c1 |
| InChI | InChI=1S/C41H34F6O10/c1-5-35(48)54-23-52-33-13-7-27(25(3)19-33)21-37(50)56-31-15-9-29(10-16-31)39(40(42,43)44,41(45,46)47)30-11-17-32(18-12-30)57-38(51)22-28-8-14-34(20-26(28)4)53-24-55-36(49)6-2/h5-20H,1-2,21-24H2,3-4H3 |
| InChIKey | WPFSAKKPYAOGDO-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.70 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|