C33H24IrNS- — CID 58769443
2-(3H-1-benzothiophen-3-id-2-yl)-5-[3,5-bis(4-methylphenyl)phenyl]pyridine;iridium (PubChem CID 58769443) has the molecular formula C33H24IrNS- and a molecular weight of 658.85 g/mol. Its IUPAC name is 2-(3H-1-benzothiophen-3-id-2-yl)-5-[3,5-bis(4-methylphenyl)phenyl]pyridine;iridium.
| Compound Name | 2-(3H-1-benzothiophen-3-id-2-yl)-5-[3,5-bis(4-methylphenyl)phenyl]pyridine;iridium |
|---|---|
| PubChem CID | 58769443 |
| Molecular Formula | C33H24IrNS- |
| Molecular Weight | 658.85 g/mol |
| Exact Mass | 659.13 |
| IUPAC Name | 2-(3H-1-benzothiophen-3-id-2-yl)-5-[3,5-bis(4-methylphenyl)phenyl]pyridine;iridium |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C)cc3)cc(-c3ccc(-c4[c-]c5ccccc5s4)nc3)c2)cc1.[Ir] |
| InChI | InChI=1S/C33H24NS.Ir/c1-22-7-11-24(12-8-22)28-17-29(25-13-9-23(2)10-14-25)19-30(18-28)27-15-16-31(34-21-27)33-20-26-5-3-4-6-32(26)35-33;/h3-19,21H,1-2H3;/q-1; |
| InChIKey | FRIHZUCILCWNOA-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.85 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|