C31H28Cl2O8S2 — CID 58769497
[7-[4-(2,5-dichlorobenzoyl)phenoxy]-3-(2,2-dimethylpropoxysulfonyl)naphthalen-1-yl]sulfanyl propaneperoxoate (PubChem CID 58769497) has the molecular formula C31H28Cl2O8S2 and a molecular weight of 663.60 g/mol. Its IUPAC name is [7-[4-(2,5-dichlorobenzoyl)phenoxy]-3-(2,2-dimethylpropoxysulfonyl)naphthalen-1-yl]sulfanyl propaneperoxoate.
| Compound Name | [7-[4-(2,5-dichlorobenzoyl)phenoxy]-3-(2,2-dimethylpropoxysulfonyl)naphthalen-1-yl]sulfanyl propaneperoxoate |
|---|---|
| PubChem CID | 58769497 |
| Molecular Formula | C31H28Cl2O8S2 |
| Molecular Weight | 663.60 g/mol |
| Exact Mass | 662.06 |
| IUPAC Name | [7-[4-(2,5-dichlorobenzoyl)phenoxy]-3-(2,2-dimethylpropoxysulfonyl)naphthalen-1-yl]sulfanyl propaneperoxoate |
| SMILES | CCC(=O)OOSc1cc(S(=O)(=O)OCC(C)(C)C)cc2ccc(Oc3ccc(C(=O)c4cc(Cl)ccc4Cl)cc3)cc12 |
| InChI | InChI=1S/C31H28Cl2O8S2/c1-5-29(34)40-41-42-28-17-24(43(36,37)38-18-31(2,3)4)14-20-8-12-23(16-25(20)28)39-22-10-6-19(7-11-22)30(35)26-15-21(32)9-13-27(26)33/h6-17H,5,18H2,1-4H3 |
| InChIKey | HOLWXKFLFADSRT-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.60 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|