About [4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate
[4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate (PubChem CID 58769642) has the molecular formula C17H20O7
and a molecular weight of 336.34 g/mol. Its IUPAC name is [4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate.
Molecular Properties
| Compound Name | [4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate |
| PubChem CID | 58769642 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate |
| SMILES | C=CC(=O)CC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C17H20O7/c1-5-13(18)9-17(10-22-14(19)6-2,11-23-15(20)7-3)12-24-16(21)8-4/h5-8H,1-4,9-12H2 |
| InChIKey | XBXIHNBFHXQODB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate?
The IUPAC name of [4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate (CID 58769642) is [4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate.
What is the SMILES notation for [4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate?
The canonical SMILES for [4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate is C=CC(=O)CC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C.
What is the InChIKey of [4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate?
The InChIKey is XBXIHNBFHXQODB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O7/c1-5-13(18)9-17(10-22-14(19)6-2,11-23-15(20)7-3)12-24-16(21)8-4/h5-8H,1-4,9-12H2.
What are the key properties of [4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate?
[4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate has a molecular weight of 336.34 g/mol, XLogP of 1.31, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-oxo-2,2-bis(prop-2-enoyloxymethyl)hex-5-enyl] prop-2-enoate is sourced from PubChem (CID 58769642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).