C29H43N5O6S — CID 58769809
(1R,2S,5S)-N-[1-(benzenesulfonylcarbamoyl)cyclopropyl]-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 58769809) has the molecular formula C29H43N5O6S and a molecular weight of 589.76 g/mol. Its IUPAC name is (1R,2S,5S)-N-[1-(benzenesulfonylcarbamoyl)cyclopropyl]-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[1-(benzenesulfonylcarbamoyl)cyclopropyl]-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 58769809 |
| Molecular Formula | C29H43N5O6S |
| Molecular Weight | 589.76 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | (1R,2S,5S)-N-[1-(benzenesulfonylcarbamoyl)cyclopropyl]-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)NC(C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC1(C(=O)NS(=O)(=O)c3ccccc3)CC1)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C29H43N5O6S/c1-26(2,3)21(30-25(38)32-27(4,5)6)23(36)34-16-18-19(28(18,7)8)20(34)22(35)31-29(14-15-29)24(37)33-41(39,40)17-12-10-9-11-13-17/h9-13,18-21H,14-16H2,1-8H3,(H,31,35)(H,33,37)(H2,30,32,38)/t18-,19-,20-,21?/m0/s1 |
| InChIKey | RJTOIMWIJVREBP-AVJWEPTDSA-N |
| XLogP | 2.14 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.76 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |