C16H28N2O2 — CID 587699
N,N,N',N'-tetraethyl-2,5-dimethylidenehexanediamide (PubChem CID 587699) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is N,N,N',N'-tetraethyl-2,5-dimethylidenehexanediamide.
| Compound Name | N,N,N',N'-tetraethyl-2,5-dimethylidenehexanediamide |
|---|---|
| PubChem CID | 587699 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | N,N,N',N'-tetraethyl-2,5-dimethylidenehexanediamide |
| SMILES | C=C(CCC(=C)C(=O)N(CC)CC)C(=O)N(CC)CC |
| InChI | InChI=1S/C16H28N2O2/c1-7-17(8-2)15(19)13(5)11-12-14(6)16(20)18(9-3)10-4/h5-12H2,1-4H3 |
| InChIKey | ZJEQBYYUPPOTIX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|