C22H30N6O2 — CID 58770024
N-[1-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]piperidin-4-yl]-2-(4-propan-2-ylphenyl)acetamide (PubChem CID 58770024) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[1-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]piperidin-4-yl]-2-(4-propan-2-ylphenyl)acetamide.
| Compound Name | N-[1-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]piperidin-4-yl]-2-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 58770024 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N-[1-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]piperidin-4-yl]-2-(4-propan-2-ylphenyl)acetamide |
| SMILES | CO/N=C/c1c(N)ncnc1N1CCC(NC(=O)Cc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C22H30N6O2/c1-15(2)17-6-4-16(5-7-17)12-20(29)27-18-8-10-28(11-9-18)22-19(13-26-30-3)21(23)24-14-25-22/h4-7,13-15,18H,8-12H2,1-3H3,(H,27,29)(H2,23,24,25)/b26-13+ |
| InChIKey | DCBRIIVNUBRRHL-LGJNPRDNSA-N |
| XLogP | 2.49 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|