C23H40ClN5 — CID 58770070
N'-[4-chloro-6-[4-(cyclohexylamino)butyl]pyrimidin-2-yl]-N-cyclohexylpropane-1,3-diamine (PubChem CID 58770070) has the molecular formula C23H40ClN5 and a molecular weight of 422.06 g/mol. Its IUPAC name is N'-[4-chloro-6-[4-(cyclohexylamino)butyl]pyrimidin-2-yl]-N-cyclohexylpropane-1,3-diamine.
| Compound Name | N'-[4-chloro-6-[4-(cyclohexylamino)butyl]pyrimidin-2-yl]-N-cyclohexylpropane-1,3-diamine |
|---|---|
| PubChem CID | 58770070 |
| Molecular Formula | C23H40ClN5 |
| Molecular Weight | 422.06 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | N'-[4-chloro-6-[4-(cyclohexylamino)butyl]pyrimidin-2-yl]-N-cyclohexylpropane-1,3-diamine |
| SMILES | Clc1cc(CCCCNC2CCCCC2)nc(NCCCNC2CCCCC2)n1 |
| InChI | InChI=1S/C23H40ClN5/c24-22-18-21(14-7-8-15-25-19-10-3-1-4-11-19)28-23(29-22)27-17-9-16-26-20-12-5-2-6-13-20/h18-20,25-26H,1-17H2,(H,27,28,29) |
| InChIKey | XXVMIWVBJNTVCC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.06 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|