C20H29NO4S2 — CID 58770075
4-[2-[(2R)-2-(3-hydroxy-3-phenylsulfanylpropyl)-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid (PubChem CID 58770075) has the molecular formula C20H29NO4S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 4-[2-[(2R)-2-(3-hydroxy-3-phenylsulfanylpropyl)-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[(2R)-2-(3-hydroxy-3-phenylsulfanylpropyl)-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 58770075 |
| Molecular Formula | C20H29NO4S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-[2-[(2R)-2-(3-hydroxy-3-phenylsulfanylpropyl)-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid |
| SMILES | O=C(O)CCCSCCN1C(=O)CCC[C@@H]1CCC(O)Sc1ccccc1 |
| InChI | InChI=1S/C20H29NO4S2/c22-18-9-4-6-16(21(18)13-15-26-14-5-10-19(23)24)11-12-20(25)27-17-7-2-1-3-8-17/h1-3,7-8,16,20,25H,4-6,9-15H2,(H,23,24)/t16-,20?/m1/s1 |
| InChIKey | QPOTYNWFYVPOJU-QRIPLOBPSA-N |
| XLogP | 3.86 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|