About trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane
trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane (PubChem CID 58770250) has the molecular formula C15H32OSi
and a molecular weight of 256.51 g/mol. Its IUPAC name is trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane.
Molecular Properties
| Compound Name | trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane |
| PubChem CID | 58770250 |
| Molecular Formula | C15H32OSi |
| Molecular Weight | 256.51 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane |
| SMILES | CC1CCC(C)(C)CC1COCC[Si](C)(C)C |
| InChI | InChI=1S/C15H32OSi/c1-13-7-8-15(2,3)11-14(13)12-16-9-10-17(4,5)6/h13-14H,7-12H2,1-6H3 |
| InChIKey | STDSDDMVXZTCRK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane?
The IUPAC name of trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane (CID 58770250) is trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane.
What is the SMILES notation for trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane?
The canonical SMILES for trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane is CC1CCC(C)(C)CC1COCC[Si](C)(C)C.
What is the InChIKey of trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane?
The InChIKey is STDSDDMVXZTCRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32OSi/c1-13-7-8-15(2,3)11-14(13)12-16-9-10-17(4,5)6/h13-14H,7-12H2,1-6H3.
What are the key properties of trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane?
trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane has a molecular weight of 256.51 g/mol, XLogP of 4.80, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2-[(2,5,5-trimethylcyclohexyl)methoxy]ethyl]silane is sourced from PubChem (CID 58770250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).