About 3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide
3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide (PubChem CID 58771091) has the molecular formula C25H36N4OS
and a molecular weight of 440.66 g/mol. Its IUPAC name is 3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide |
| PubChem CID | 58771091 |
| Molecular Formula | C25H36N4OS |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)c1ccc2nc(-c3ccsc3)n(CCCN)c2c1 |
| InChI | InChI=1S/C25H36N4OS/c1-18(2)8-13-28(14-9-19(3)4)25(30)20-6-7-22-23(16-20)29(12-5-11-26)24(27-22)21-10-15-31-17-21/h6-7,10,15-19H,5,8-9,11-14,26H2,1-4H3 |
| InChIKey | MBQTXLWFEWXTHL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide?
The IUPAC name of 3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide (CID 58771091) is 3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide.
What is the SMILES notation for 3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide?
The canonical SMILES for 3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide is CC(C)CCN(CCC(C)C)C(=O)c1ccc2nc(-c3ccsc3)n(CCCN)c2c1.
What is the InChIKey of 3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide?
The InChIKey is MBQTXLWFEWXTHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36N4OS/c1-18(2)8-13-28(14-9-19(3)4)25(30)20-6-7-22-23(16-20)29(12-5-11-26)24(27-22)21-10-15-31-17-21/h6-7,10,15-19H,5,8-9,11-14,26H2,1-4H3.
What are the key properties of 3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide?
3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide has a molecular weight of 440.66 g/mol, XLogP of 5.65, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-aminopropyl)-N,N-bis(3-methylbutyl)-2-thiophen-3-ylbenzimidazole-5-carboxamide is sourced from PubChem (CID 58771091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).