C20H41BrO — CID 58771185
1-bromo-2-methoxy-2,6,10,14-tetramethylpentadecane (PubChem CID 58771185) has the molecular formula C20H41BrO and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-bromo-2-methoxy-2,6,10,14-tetramethylpentadecane.
| Compound Name | 1-bromo-2-methoxy-2,6,10,14-tetramethylpentadecane |
|---|---|
| PubChem CID | 58771185 |
| Molecular Formula | C20H41BrO |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 1-bromo-2-methoxy-2,6,10,14-tetramethylpentadecane |
| SMILES | COC(C)(CBr)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H41BrO/c1-17(2)10-7-11-18(3)12-8-13-19(4)14-9-15-20(5,16-21)22-6/h17-19H,7-16H2,1-6H3 |
| InChIKey | NDFDGDVTNVUHLK-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|