C10H2F16O2 — CID 58771227
2-(difluoromethylidene)-4-fluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,3-dioxolane (PubChem CID 58771227) has the molecular formula C10H2F16O2 and a molecular weight of 458.09 g/mol. Its IUPAC name is 2-(difluoromethylidene)-4-fluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,3-dioxolane.
| Compound Name | 2-(difluoromethylidene)-4-fluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 58771227 |
| Molecular Formula | C10H2F16O2 |
| Molecular Weight | 458.09 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | 2-(difluoromethylidene)-4-fluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,3-dioxolane |
| SMILES | FC(F)=C1OCC(F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C10H2F16O2/c11-2(12)3-27-1-4(13,28-3)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)26/h1H2 |
| InChIKey | OANQWPFDOBGUFV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.09 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|