About N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide
N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide (PubChem CID 58771414) has the molecular formula C17H21N3O5
and a molecular weight of 347.37 g/mol. Its IUPAC name is N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide |
| PubChem CID | 58771414 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide |
| SMILES | CC(=O)NC(CCCN1C(=O)C=CC1=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H21N3O5/c1-12(21)18-13(4-2-10-19-14(22)6-7-15(19)23)5-3-11-20-16(24)8-9-17(20)25/h6-9,13H,2-5,10-11H2,1H3,(H,18,21) |
| InChIKey | FDDDONXHOQFISV-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide?
The IUPAC name of N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide (CID 58771414) is N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide.
What is the SMILES notation for N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide?
The canonical SMILES for N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide is CC(=O)NC(CCCN1C(=O)C=CC1=O)CCCN1C(=O)C=CC1=O.
What is the InChIKey of N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide?
The InChIKey is FDDDONXHOQFISV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O5/c1-12(21)18-13(4-2-10-19-14(22)6-7-15(19)23)5-3-11-20-16(24)8-9-17(20)25/h6-9,13H,2-5,10-11H2,1H3,(H,18,21).
What are the key properties of N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide?
N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide has a molecular weight of 347.37 g/mol, XLogP of -0.10, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-yl]acetamide is sourced from PubChem (CID 58771414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).