About N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide
N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide (PubChem CID 58771416) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide |
| PubChem CID | 58771416 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H16N2O3/c1-8(12-9(2)14)4-3-7-13-10(15)5-6-11(13)16/h5-6,8H,3-4,7H2,1-2H3,(H,12,14) |
| InChIKey | HRDAWHBFVBZFCD-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide?
The IUPAC name of N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide (CID 58771416) is N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide.
What is the SMILES notation for N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide?
The canonical SMILES for N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide is CC(=O)NC(C)CCCN1C(=O)C=CC1=O.
What is the InChIKey of N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide?
The InChIKey is HRDAWHBFVBZFCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-8(12-9(2)14)4-3-7-13-10(15)5-6-11(13)16/h5-6,8H,3-4,7H2,1-2H3,(H,12,14).
What are the key properties of N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide?
N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide has a molecular weight of 224.26 g/mol, XLogP of 0.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2,5-dioxopyrrol-1-yl)pentan-2-yl]acetamide is sourced from PubChem (CID 58771416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).