C25H35N5O9 — CID 58771417
methyl N-[1-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-ylamino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 58771417) has the molecular formula C25H35N5O9 and a molecular weight of 549.58 g/mol. Its IUPAC name is methyl N-[1-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-ylamino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | methyl N-[1-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-ylamino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 58771417 |
| Molecular Formula | C25H35N5O9 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | methyl N-[1-[1,7-bis(2,5-dioxopyrrol-1-yl)heptan-4-ylamino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | COC(=O)NCCCCC(NC(=O)OC)C(=O)NC(CCCN1C(=O)C=CC1=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C25H35N5O9/c1-38-24(36)26-14-4-3-9-18(28-25(37)39-2)23(35)27-17(7-5-15-29-19(31)10-11-20(29)32)8-6-16-30-21(33)12-13-22(30)34/h10-13,17-18H,3-9,14-16H2,1-2H3,(H,26,36)(H,27,35)(H,28,37) |
| InChIKey | NFGPBXBJCXJPAG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 180.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|