C19H29N5O8 — CID 58771418
methyl N-[1-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-2-(methoxycarbonylamino)-1-oxohexan-3-yl]carbamate (PubChem CID 58771418) has the molecular formula C19H29N5O8 and a molecular weight of 455.47 g/mol. Its IUPAC name is methyl N-[1-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-2-(methoxycarbonylamino)-1-oxohexan-3-yl]carbamate.
| Compound Name | methyl N-[1-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-2-(methoxycarbonylamino)-1-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 58771418 |
| Molecular Formula | C19H29N5O8 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | methyl N-[1-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-2-(methoxycarbonylamino)-1-oxohexan-3-yl]carbamate |
| SMILES | CCCC(NC(=O)OC)C(NC(=O)OC)C(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H29N5O8/c1-4-5-12(22-18(29)31-2)16(23-19(30)32-3)17(28)21-10-9-20-13(25)8-11-24-14(26)6-7-15(24)27/h6-7,12,16H,4-5,8-11H2,1-3H3,(H,20,25)(H,21,28)(H,22,29)(H,23,30) |
| InChIKey | HXRMSABSRZMCKZ-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 172.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|