C27H37NO2 — CID 58771938
1-[2-[3-[1-[(2R,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]-4-methoxyphenyl]ethynyl]cyclohexan-1-ol (PubChem CID 58771938) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 1-[2-[3-[1-[(2R,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]-4-methoxyphenyl]ethynyl]cyclohexan-1-ol.
| Compound Name | 1-[2-[3-[1-[(2R,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]-4-methoxyphenyl]ethynyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 58771938 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 1-[2-[3-[1-[(2R,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]-4-methoxyphenyl]ethynyl]cyclohexan-1-ol |
| SMILES | COc1ccc(C#CC2(O)CCCCC2)cc1C1CCN([C@@H]2C[C@H]3CCC2C3)CC1 |
| InChI | InChI=1S/C27H37NO2/c1-30-26-8-6-20(9-14-27(29)12-3-2-4-13-27)18-24(26)22-10-15-28(16-11-22)25-19-21-5-7-23(25)17-21/h6,8,18,21-23,25,29H,2-5,7,10-13,15-17,19H2,1H3/t21-,23?,25+/m0/s1 |
| InChIKey | IARGVAYTISACLE-KVCNQYIISA-N |
| XLogP | 5.11 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|