About 2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol
2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol (PubChem CID 58772232) has the molecular formula C18H25NO
and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol.
Molecular Properties
| Compound Name | 2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol |
| PubChem CID | 58772232 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol |
| SMILES | Oc1ccccc1C1CCN([C@H]2C[C@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C18H25NO/c20-18-4-2-1-3-16(18)14-7-9-19(10-8-14)17-12-13-5-6-15(17)11-13/h1-4,13-15,17,20H,5-12H2/t13-,15-,17-/m0/s1 |
| InChIKey | PCLFOLBPVXOLBB-QRTARXTBSA-N |
| XLogP | 3.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol?
The IUPAC name of 2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol (CID 58772232) is 2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol.
What is the SMILES notation for 2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol?
The canonical SMILES for 2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol is Oc1ccccc1C1CCN([C@H]2C[C@H]3CC[C@H]2C3)CC1.
What is the InChIKey of 2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol?
The InChIKey is PCLFOLBPVXOLBB-QRTARXTBSA-N. The full InChI is InChI=1S/C18H25NO/c20-18-4-2-1-3-16(18)14-7-9-19(10-8-14)17-12-13-5-6-15(17)11-13/h1-4,13-15,17,20H,5-12H2/t13-,15-,17-/m0/s1.
What are the key properties of 2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol?
2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol has a molecular weight of 271.40 g/mol, XLogP of 3.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]phenol is sourced from PubChem (CID 58772232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).