C17H35N — CID 58772476
1,4-ditert-butyl-2,3,5,6-tetramethylpiperidine (PubChem CID 58772476) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,3,5,6-tetramethylpiperidine.
| Compound Name | 1,4-ditert-butyl-2,3,5,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 58772476 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | 1,4-ditert-butyl-2,3,5,6-tetramethylpiperidine |
| SMILES | CC1C(C)N(C(C)(C)C)C(C)C(C)C1C(C)(C)C |
| InChI | InChI=1S/C17H35N/c1-11-13(3)18(17(8,9)10)14(4)12(2)15(11)16(5,6)7/h11-15H,1-10H3 |
| InChIKey | DPAGZBQCPYQFDC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |