C29H35FN3O7- — CID 58773064
(3R,5R)-7-[4-[[(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]carbamoyl]-2-(4-fluorophenyl)-5-propan-2-ylimidazol-1-yl]-3,5-dihydroxyheptanoate (PubChem CID 58773064) has the molecular formula C29H35FN3O7- and a molecular weight of 556.61 g/mol. Its IUPAC name is (3R,5R)-7-[4-[[(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]carbamoyl]-2-(4-fluorophenyl)-5-propan-2-ylimidazol-1-yl]-3,5-dihydroxyheptanoate.
| Compound Name | (3R,5R)-7-[4-[[(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]carbamoyl]-2-(4-fluorophenyl)-5-propan-2-ylimidazol-1-yl]-3,5-dihydroxyheptanoate |
|---|---|
| PubChem CID | 58773064 |
| Molecular Formula | C29H35FN3O7- |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | (3R,5R)-7-[4-[[(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]carbamoyl]-2-(4-fluorophenyl)-5-propan-2-ylimidazol-1-yl]-3,5-dihydroxyheptanoate |
| SMILES | CC(C)c1c(C(=O)N[C@H](CO)[C@H](O)c2ccccc2)nc(-c2ccc(F)cc2)n1CC[C@@H](O)C[C@@H](O)CC(=O)[O-] |
| InChI | InChI=1S/C29H36FN3O7/c1-17(2)26-25(29(40)31-23(16-34)27(39)18-6-4-3-5-7-18)32-28(19-8-10-20(30)11-9-19)33(26)13-12-21(35)14-22(36)15-24(37)38/h3-11,17,21-23,27,34-36,39H,12-16H2,1-2H3,(H,31,40)(H,37,38)/p-1/t21-,22-,23-,27-/m1/s1 |
| InChIKey | QETRJDCLIURKRZ-DVAKJLRASA-M |
| XLogP | 1.28 |
| TPSA | 167.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |