C29H30F6N2O4 — CID 58773099
(2,3,4,5,6-pentafluorophenyl) 1-[2-[(4R,6S)-6-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-2-(4-fluorophenyl)-5-propan-2-ylimidazole-4-carboxylate (PubChem CID 58773099) has the molecular formula C29H30F6N2O4 and a molecular weight of 584.56 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 1-[2-[(4R,6S)-6-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-2-(4-fluorophenyl)-5-propan-2-ylimidazole-4-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 1-[2-[(4R,6S)-6-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-2-(4-fluorophenyl)-5-propan-2-ylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 58773099 |
| Molecular Formula | C29H30F6N2O4 |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 1-[2-[(4R,6S)-6-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-2-(4-fluorophenyl)-5-propan-2-ylimidazole-4-carboxylate |
| SMILES | CC[C@H]1C[C@@H](CCn2c(-c3ccc(F)cc3)nc(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)c2C(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C29H30F6N2O4/c1-6-17-13-18(41-29(4,5)40-17)11-12-37-25(14(2)3)24(36-27(37)15-7-9-16(30)10-8-15)28(38)39-26-22(34)20(32)19(31)21(33)23(26)35/h7-10,14,17-18H,6,11-13H2,1-5H3/t17-,18+/m0/s1 |
| InChIKey | OELGOUMKHCWOID-ZWKOTPCHSA-N |
| XLogP | 7.44 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|