About 8-methylnon-8-en-1,3,5-triyne
8-methylnon-8-en-1,3,5-triyne (PubChem CID 58773331) has the molecular formula C10H8
and a molecular weight of 128.17 g/mol. Its IUPAC name is 8-methylnon-8-en-1,3,5-triyne.
Molecular Properties
| Compound Name | 8-methylnon-8-en-1,3,5-triyne |
| PubChem CID | 58773331 |
| Molecular Formula | C10H8 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 8-methylnon-8-en-1,3,5-triyne |
| SMILES | C#CC#CC#CCC(=C)C |
| InChI | InChI=1S/C10H8/c1-4-5-6-7-8-9-10(2)3/h1H,2,9H2,3H3 |
| InChIKey | RRNOUMSJDGQNOX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-methylnon-8-en-1,3,5-triyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylnon-8-en-1,3,5-triyne?
The IUPAC name of 8-methylnon-8-en-1,3,5-triyne (CID 58773331) is 8-methylnon-8-en-1,3,5-triyne.
What is the SMILES notation for 8-methylnon-8-en-1,3,5-triyne?
The canonical SMILES for 8-methylnon-8-en-1,3,5-triyne is C#CC#CC#CCC(=C)C.
What is the InChIKey of 8-methylnon-8-en-1,3,5-triyne?
The InChIKey is RRNOUMSJDGQNOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8/c1-4-5-6-7-8-9-10(2)3/h1H,2,9H2,3H3.
What are the key properties of 8-methylnon-8-en-1,3,5-triyne?
8-methylnon-8-en-1,3,5-triyne has a molecular weight of 128.17 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylnon-8-en-1,3,5-triyne is sourced from PubChem (CID 58773331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).