C30H26FNO6 — CID 58773606
12-(3-ethoxy-4-methoxyphenyl)-8-fluoro-16,17-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5(10),6,8,12,14,16,18-octaen-3-one (PubChem CID 58773606) has the molecular formula C30H26FNO6 and a molecular weight of 515.54 g/mol. Its IUPAC name is 12-(3-ethoxy-4-methoxyphenyl)-8-fluoro-16,17-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5(10),6,8,12,14,16,18-octaen-3-one.
| Compound Name | 12-(3-ethoxy-4-methoxyphenyl)-8-fluoro-16,17-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5(10),6,8,12,14,16,18-octaen-3-one |
|---|---|
| PubChem CID | 58773606 |
| Molecular Formula | C30H26FNO6 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 12-(3-ethoxy-4-methoxyphenyl)-8-fluoro-16,17-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5(10),6,8,12,14,16,18-octaen-3-one |
| SMILES | CCOc1cc(-c2c3n(c4c(=O)oc5ccc(F)cc5c24)CCc2cc(OC)c(OC)cc2-3)ccc1OC |
| InChI | InChI=1S/C30H26FNO6/c1-5-37-25-13-17(6-8-22(25)34-2)26-27-20-14-18(31)7-9-21(20)38-30(33)29(27)32-11-10-16-12-23(35-3)24(36-4)15-19(16)28(26)32/h6-9,12-15H,5,10-11H2,1-4H3 |
| InChIKey | LCLZLGBIEYLTES-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 72.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|