C20H24O7S2 — CID 58773635
2-[2-[2-(benzenesulfonyl)ethyl]-1,3-dioxolan-2-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 58773635) has the molecular formula C20H24O7S2 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-[2-[2-(benzenesulfonyl)ethyl]-1,3-dioxolan-2-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-(benzenesulfonyl)ethyl]-1,3-dioxolan-2-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58773635 |
| Molecular Formula | C20H24O7S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2-[2-[2-(benzenesulfonyl)ethyl]-1,3-dioxolan-2-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC2(CCS(=O)(=O)c3ccccc3)OCCO2)cc1 |
| InChI | InChI=1S/C20H24O7S2/c1-17-7-9-19(10-8-17)29(23,24)27-13-11-20(25-14-15-26-20)12-16-28(21,22)18-5-3-2-4-6-18/h2-10H,11-16H2,1H3 |
| InChIKey | MMGZSSDYWKZUGN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|